C13H5ClF4O — CID 107475712
(2-chloro-4,5-difluorophenyl)-(2,3-difluorophenyl)methanone (PubChem CID 107475712) has the molecular formula C13H5ClF4O and a molecular weight of 288.63 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-(2,3-difluorophenyl)methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-(2,3-difluorophenyl)methanone |
|---|---|
| PubChem CID | 107475712 |
| Molecular Formula | C13H5ClF4O |
| Molecular Weight | 288.63 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-(2,3-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)c1cccc(F)c1F |
| InChI | InChI=1S/C13H5ClF4O/c14-8-5-11(17)10(16)4-7(8)13(19)6-2-1-3-9(15)12(6)18/h1-5H |
| InChIKey | IGJWZIVVMNWXAM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|