About (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone
(2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone (PubChem CID 57049068) has the molecular formula C14H7F5O2
and a molecular weight of 302.20 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone |
| PubChem CID | 57049068 |
| Molecular Formula | C14H7F5O2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone |
| SMILES | COc1c(C(=O)c2cccc(F)c2F)cc(F)c(F)c1F |
| InChI | InChI=1S/C14H7F5O2/c1-21-14-7(5-9(16)11(18)12(14)19)13(20)6-3-2-4-8(15)10(6)17/h2-5H,1H3 |
| InChIKey | LXGKNQOISJEGKH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone?
The IUPAC name of (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone (CID 57049068) is (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone.
What is the SMILES notation for (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone?
The canonical SMILES for (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone is COc1c(C(=O)c2cccc(F)c2F)cc(F)c(F)c1F.
What is the InChIKey of (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone?
The InChIKey is LXGKNQOISJEGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7F5O2/c1-21-14-7(5-9(16)11(18)12(14)19)13(20)6-3-2-4-8(15)10(6)17/h2-5H,1H3.
What are the key properties of (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone?
(2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone has a molecular weight of 302.20 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluorophenyl)-(3,4,5-trifluoro-2-methoxyphenyl)methanone is sourced from PubChem (CID 57049068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).