C14H10F2O — CID 63987550
(2,3-difluorophenyl)-(3-methylphenyl)methanone (PubChem CID 63987550) has the molecular formula C14H10F2O and a molecular weight of 232.23 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(3-methylphenyl)methanone.
| Compound Name | (2,3-difluorophenyl)-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 63987550 |
| Molecular Formula | C14H10F2O |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2,3-difluorophenyl)-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C14H10F2O/c1-9-4-2-5-10(8-9)14(17)11-6-3-7-12(15)13(11)16/h2-8H,1H3 |
| InChIKey | MZCSGXYKJBAKDU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |