C14H9BrF2O — CID 114973529
(3-bromo-2-methylphenyl)-(2,3-difluorophenyl)methanone (PubChem CID 114973529) has the molecular formula C14H9BrF2O and a molecular weight of 311.12 g/mol. Its IUPAC name is (3-bromo-2-methylphenyl)-(2,3-difluorophenyl)methanone.
| Compound Name | (3-bromo-2-methylphenyl)-(2,3-difluorophenyl)methanone |
|---|---|
| PubChem CID | 114973529 |
| Molecular Formula | C14H9BrF2O |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | (3-bromo-2-methylphenyl)-(2,3-difluorophenyl)methanone |
| SMILES | Cc1c(Br)cccc1C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C14H9BrF2O/c1-8-9(4-2-6-11(8)15)14(18)10-5-3-7-12(16)13(10)17/h2-7H,1H3 |
| InChIKey | QQSXTRSIUJCZKE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |