About 2,3-difluorobenzoyl bromide
2,3-difluorobenzoyl bromide (PubChem CID 91168195) has the molecular formula C7H3BrF2O
and a molecular weight of 221.00 g/mol. Its IUPAC name is 2,3-difluorobenzoyl bromide.
Molecular Properties
| Compound Name | 2,3-difluorobenzoyl bromide |
| PubChem CID | 91168195 |
| Molecular Formula | C7H3BrF2O |
| Molecular Weight | 221.00 g/mol |
| Exact Mass | 219.93 |
| IUPAC Name | 2,3-difluorobenzoyl bromide |
| SMILES | O=C(Br)c1cccc(F)c1F |
| InChI | InChI=1S/C7H3BrF2O/c8-7(11)4-2-1-3-5(9)6(4)10/h1-3H |
| InChIKey | PWAZQCSGBUSHPJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.00 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-difluorobenzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluorobenzoyl bromide?
The IUPAC name of 2,3-difluorobenzoyl bromide (CID 91168195) is 2,3-difluorobenzoyl bromide.
What is the SMILES notation for 2,3-difluorobenzoyl bromide?
The canonical SMILES for 2,3-difluorobenzoyl bromide is O=C(Br)c1cccc(F)c1F.
What is the InChIKey of 2,3-difluorobenzoyl bromide?
The InChIKey is PWAZQCSGBUSHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrF2O/c8-7(11)4-2-1-3-5(9)6(4)10/h1-3H.
What are the key properties of 2,3-difluorobenzoyl bromide?
2,3-difluorobenzoyl bromide has a molecular weight of 221.00 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluorobenzoyl bromide is sourced from PubChem (CID 91168195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).