About N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide
N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide (PubChem CID 87474949) has the molecular formula C8H3F5N2O2
and a molecular weight of 254.11 g/mol. Its IUPAC name is N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide.
Molecular Properties
| Compound Name | N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide |
| PubChem CID | 87474949 |
| Molecular Formula | C8H3F5N2O2 |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide |
| SMILES | O=C(c1cccc(F)c1F)N(F)C(=O)N(F)F |
| InChI | InChI=1S/C8H3F5N2O2/c9-5-3-1-2-4(6(5)10)7(16)14(11)8(17)15(12)13/h1-3H |
| InChIKey | QOVRLXZWYNZWJO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide?
The IUPAC name of N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide (CID 87474949) is N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide.
What is the SMILES notation for N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide?
The canonical SMILES for N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide is O=C(c1cccc(F)c1F)N(F)C(=O)N(F)F.
What is the InChIKey of N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide?
The InChIKey is QOVRLXZWYNZWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F5N2O2/c9-5-3-1-2-4(6(5)10)7(16)14(11)8(17)15(12)13/h1-3H.
What are the key properties of N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide?
N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide has a molecular weight of 254.11 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide is sourced from PubChem (CID 87474949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).