C8H3F5N2O2 — CID 87474949
N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide (PubChem CID 87474949) has the molecular formula C8H3F5N2O2 and a molecular weight of 254.11 g/mol. Its IUPAC name is N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide.
| Compound Name | N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide |
|---|---|
| PubChem CID | 87474949 |
| Molecular Formula | C8H3F5N2O2 |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | N-(difluorocarbamoyl)-N,2,3-trifluorobenzamide |
| SMILES | O=C(c1cccc(F)c1F)N(F)C(=O)N(F)F |
| InChI | InChI=1S/C8H3F5N2O2/c9-5-3-1-2-4(6(5)10)7(16)14(11)8(17)15(12)13/h1-3H |
| InChIKey | QOVRLXZWYNZWJO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|