C13H17F2NO3 — CID 62661170
2,3-difluoro-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 62661170) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2,3-difluoro-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 2,3-difluoro-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 62661170 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2,3-difluoro-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCOC)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C13H17F2NO3/c1-18-8-6-16(7-9-19-2)13(17)10-4-3-5-11(14)12(10)15/h3-5H,6-9H2,1-2H3 |
| InChIKey | YSTHVFOFVIDZTF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |