C14H21NO4 — CID 60653742
2-hydroxy-N,N-bis(2-methoxyethyl)-3-methylbenzamide (PubChem CID 60653742) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-hydroxy-N,N-bis(2-methoxyethyl)-3-methylbenzamide.
| Compound Name | 2-hydroxy-N,N-bis(2-methoxyethyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 60653742 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-hydroxy-N,N-bis(2-methoxyethyl)-3-methylbenzamide |
| SMILES | COCCN(CCOC)C(=O)c1cccc(C)c1O |
| InChI | InChI=1S/C14H21NO4/c1-11-5-4-6-12(13(11)16)14(17)15(7-9-18-2)8-10-19-3/h4-6,16H,7-10H2,1-3H3 |
| InChIKey | MUSZTPVGAXHNRO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |