C15H23NO5S — CID 55435906
2-ethylsulfonyl-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 55435906) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-ethylsulfonyl-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 2-ethylsulfonyl-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 55435906 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-ethylsulfonyl-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N(CCOC)CCOC |
| InChI | InChI=1S/C15H23NO5S/c1-4-22(18,19)14-8-6-5-7-13(14)15(17)16(9-11-20-2)10-12-21-3/h5-8H,4,9-12H2,1-3H3 |
| InChIKey | LNWFJSNPDLMBSE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |