C14H20FNO3 — CID 54915998
2-fluoro-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide (PubChem CID 54915998) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-fluoro-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide.
| Compound Name | 2-fluoro-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 54915998 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-fluoro-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CCOC)C(=O)c1ccccc1F |
| InChI | InChI=1S/C14H20FNO3/c1-18-10-5-8-16(9-11-19-2)14(17)12-6-3-4-7-13(12)15/h3-4,6-7H,5,8-11H2,1-2H3 |
| InChIKey | HGYUFHPYZBGHBB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|