C19H27F4N3O6S — CID 146061645
2-fluoro-N-(3-methoxypropyl)-N-(2-piperazin-1-ylsulfonylethyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 146061645) has the molecular formula C19H27F4N3O6S and a molecular weight of 501.50 g/mol. Its IUPAC name is 2-fluoro-N-(3-methoxypropyl)-N-(2-piperazin-1-ylsulfonylethyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-fluoro-N-(3-methoxypropyl)-N-(2-piperazin-1-ylsulfonylethyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146061645 |
| Molecular Formula | C19H27F4N3O6S |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 2-fluoro-N-(3-methoxypropyl)-N-(2-piperazin-1-ylsulfonylethyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCCN(CCS(=O)(=O)N1CCNCC1)C(=O)c1ccccc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26FN3O4S.C2HF3O2/c1-25-13-4-9-20(17(22)15-5-2-3-6-16(15)18)12-14-26(23,24)21-10-7-19-8-11-21;3-2(4,5)1(6)7/h2-3,5-6,19H,4,7-14H2,1H3;(H,6,7) |
| InChIKey | NBANBLRQSNASMV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|