C19H28F3N3O6S — CID 146061651
N-(3-methoxypropyl)-N-(2-piperazin-1-ylsulfonylethyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 146061651) has the molecular formula C19H28F3N3O6S and a molecular weight of 483.51 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-(2-piperazin-1-ylsulfonylethyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-methoxypropyl)-N-(2-piperazin-1-ylsulfonylethyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146061651 |
| Molecular Formula | C19H28F3N3O6S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-(3-methoxypropyl)-N-(2-piperazin-1-ylsulfonylethyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCCN(CCS(=O)(=O)N1CCNCC1)C(=O)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O4S.C2HF3O2/c1-24-14-5-10-19(17(21)16-6-3-2-4-7-16)13-15-25(22,23)20-11-8-18-9-12-20;3-2(4,5)1(6)7/h2-4,6-7,18H,5,8-15H2,1H3;(H,6,7) |
| InChIKey | LSHXIFBJYCNAJV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|