C18H22FN3O3S — CID 4302806
N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-2-fluoro-N-(3-methoxypropyl)benzamide (PubChem CID 4302806) has the molecular formula C18H22FN3O3S and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-2-fluoro-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-2-fluoro-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4302806 |
| Molecular Formula | C18H22FN3O3S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-2-fluoro-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)Nc1nc(C)c(C)s1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C18H22FN3O3S/c1-12-13(2)26-18(20-12)21-16(23)11-22(9-6-10-25-3)17(24)14-7-4-5-8-15(14)19/h4-5,7-8H,6,9-11H2,1-3H3,(H,20,21,23) |
| InChIKey | CHLQYIHOTSSKFC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|