C20H27N3O4S — CID 4226699
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-[3-methoxypropyl-(2-phenylmethoxyacetyl)amino]acetamide (PubChem CID 4226699) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-[3-methoxypropyl-(2-phenylmethoxyacetyl)amino]acetamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-[3-methoxypropyl-(2-phenylmethoxyacetyl)amino]acetamide |
|---|---|
| PubChem CID | 4226699 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-[3-methoxypropyl-(2-phenylmethoxyacetyl)amino]acetamide |
| SMILES | COCCCN(CC(=O)Nc1nc(C)c(C)s1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C20H27N3O4S/c1-15-16(2)28-20(21-15)22-18(24)12-23(10-7-11-26-3)19(25)14-27-13-17-8-5-4-6-9-17/h4-6,8-9H,7,10-14H2,1-3H3,(H,21,22,24) |
| InChIKey | UQNRUQDLRAEQLP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|