C19H24N2O6 — CID 4997781
methyl 2-[[3-methoxypropyl-(2-phenylmethoxyacetyl)amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 4997781) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 2-[[3-methoxypropyl-(2-phenylmethoxyacetyl)amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[3-methoxypropyl-(2-phenylmethoxyacetyl)amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4997781 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | methyl 2-[[3-methoxypropyl-(2-phenylmethoxyacetyl)amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COCCCN(Cc1nc(C(=O)OC)co1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C19H24N2O6/c1-24-10-6-9-21(11-17-20-16(13-27-17)19(23)25-2)18(22)14-26-12-15-7-4-3-5-8-15/h3-5,7-8,13H,6,9-12,14H2,1-2H3 |
| InChIKey | KEJKDGISOCSJHK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|