C21H22N2O5 — CID 5041718
methyl 2-[[3-methoxypropyl(naphthalene-1-carbonyl)amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 5041718) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 2-[[3-methoxypropyl(naphthalene-1-carbonyl)amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[3-methoxypropyl(naphthalene-1-carbonyl)amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 5041718 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl 2-[[3-methoxypropyl(naphthalene-1-carbonyl)amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COCCCN(Cc1nc(C(=O)OC)co1)C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H22N2O5/c1-26-12-6-11-23(13-19-22-18(14-28-19)21(25)27-2)20(24)17-10-5-8-15-7-3-4-9-16(15)17/h3-5,7-10,14H,6,11-13H2,1-2H3 |
| InChIKey | VTYWZIGYEYNIQG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|