C17H19F2N3O5 — CID 4030458
methyl 2-[[(3,4-difluorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 4030458) has the molecular formula C17H19F2N3O5 and a molecular weight of 383.35 g/mol. Its IUPAC name is methyl 2-[[(3,4-difluorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(3,4-difluorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4030458 |
| Molecular Formula | C17H19F2N3O5 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | methyl 2-[[(3,4-difluorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COCCCN(Cc1nc(C(=O)OC)co1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H19F2N3O5/c1-25-7-3-6-22(9-15-21-14(10-27-15)16(23)26-2)17(24)20-11-4-5-12(18)13(19)8-11/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,20,24) |
| InChIKey | PQBZJLAEOKXAHD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|