C21H30N4O6 — CID 3945915
2-[[(3-methoxyphenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide (PubChem CID 3945915) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[[(3-methoxyphenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[(3-methoxyphenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3945915 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-[[(3-methoxyphenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1coc(CN(CCCOC)C(=O)Nc2cccc(OC)c2)n1 |
| InChI | InChI=1S/C21H30N4O6/c1-28-11-5-9-22-20(26)18-15-31-19(24-18)14-25(10-6-12-29-2)21(27)23-16-7-4-8-17(13-16)30-3/h4,7-8,13,15H,5-6,9-12,14H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | WQKSIMBLNLMMQV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|