C22H31FN4O5 — CID 3993680
N-(3-ethoxypropyl)-2-[[3-ethoxypropyl-[(2-fluorophenyl)carbamoyl]amino]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 3993680) has the molecular formula C22H31FN4O5 and a molecular weight of 450.51 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[[3-ethoxypropyl-[(2-fluorophenyl)carbamoyl]amino]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-2-[[3-ethoxypropyl-[(2-fluorophenyl)carbamoyl]amino]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3993680 |
| Molecular Formula | C22H31FN4O5 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[[3-ethoxypropyl-[(2-fluorophenyl)carbamoyl]amino]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCOCCCNC(=O)c1coc(CN(CCCOCC)C(=O)Nc2ccccc2F)n1 |
| InChI | InChI=1S/C22H31FN4O5/c1-3-30-13-7-11-24-21(28)19-16-32-20(25-19)15-27(12-8-14-31-4-2)22(29)26-18-10-6-5-9-17(18)23/h5-6,9-10,16H,3-4,7-8,11-15H2,1-2H3,(H,24,28)(H,26,29) |
| InChIKey | JSFWWLIXHFTWMO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|