C20H34ClN3O5 — CID 3645479
2-[[(3-chloro-2,2-dimethylpropanoyl)-(3-ethoxypropyl)amino]methyl]-N-(3-ethoxypropyl)-1,3-oxazole-4-carboxamide (PubChem CID 3645479) has the molecular formula C20H34ClN3O5 and a molecular weight of 431.96 g/mol. Its IUPAC name is 2-[[(3-chloro-2,2-dimethylpropanoyl)-(3-ethoxypropyl)amino]methyl]-N-(3-ethoxypropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[(3-chloro-2,2-dimethylpropanoyl)-(3-ethoxypropyl)amino]methyl]-N-(3-ethoxypropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3645479 |
| Molecular Formula | C20H34ClN3O5 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[[(3-chloro-2,2-dimethylpropanoyl)-(3-ethoxypropyl)amino]methyl]-N-(3-ethoxypropyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCOCCCNC(=O)c1coc(CN(CCCOCC)C(=O)C(C)(C)CCl)n1 |
| InChI | InChI=1S/C20H34ClN3O5/c1-5-27-11-7-9-22-18(25)16-14-29-17(23-16)13-24(10-8-12-28-6-2)19(26)20(3,4)15-21/h14H,5-13,15H2,1-4H3,(H,22,25) |
| InChIKey | XLFIQUQEXNHJLW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|