C17H29N3O3 — CID 4242407
2-[[acetyl(pentyl)amino]methyl]-N-pentyl-1,3-oxazole-4-carboxamide (PubChem CID 4242407) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[[acetyl(pentyl)amino]methyl]-N-pentyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[acetyl(pentyl)amino]methyl]-N-pentyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 4242407 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2-[[acetyl(pentyl)amino]methyl]-N-pentyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1coc(CN(CCCCC)C(C)=O)n1 |
| InChI | InChI=1S/C17H29N3O3/c1-4-6-8-10-18-17(22)15-13-23-16(19-15)12-20(14(3)21)11-9-7-5-2/h13H,4-12H2,1-3H3,(H,18,22) |
| InChIKey | UBDZXZQIJNGKOO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|