C23H41N3O5 — CID 3654856
N-(3-ethoxypropyl)-2-[[3-ethoxypropyl(octanoyl)amino]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 3654856) has the molecular formula C23H41N3O5 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[[3-ethoxypropyl(octanoyl)amino]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-2-[[3-ethoxypropyl(octanoyl)amino]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3654856 |
| Molecular Formula | C23H41N3O5 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[[3-ethoxypropyl(octanoyl)amino]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCCC(=O)N(CCCOCC)Cc1nc(C(=O)NCCCOCC)co1 |
| InChI | InChI=1S/C23H41N3O5/c1-4-7-8-9-10-13-22(27)26(15-12-17-30-6-3)18-21-25-20(19-31-21)23(28)24-14-11-16-29-5-2/h19H,4-18H2,1-3H3,(H,24,28) |
| InChIKey | HHGDDZKGJUETHW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|