C21H37N3O3 — CID 3890985
N-(2-methylpropyl)-2-[[2-methylpropyl(octanoyl)amino]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 3890985) has the molecular formula C21H37N3O3 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-[[2-methylpropyl(octanoyl)amino]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2-methylpropyl)-2-[[2-methylpropyl(octanoyl)amino]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3890985 |
| Molecular Formula | C21H37N3O3 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | N-(2-methylpropyl)-2-[[2-methylpropyl(octanoyl)amino]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCCC(=O)N(Cc1nc(C(=O)NCC(C)C)co1)CC(C)C |
| InChI | InChI=1S/C21H37N3O3/c1-6-7-8-9-10-11-20(25)24(13-17(4)5)14-19-23-18(15-27-19)21(26)22-12-16(2)3/h15-17H,6-14H2,1-5H3,(H,22,26) |
| InChIKey | FCETXTCGLAWFCY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|