C20H27N5O5 — CID 3531368
N-(2-methylpropyl)-2-[[2-methylpropyl-[(4-nitrophenyl)carbamoyl]amino]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 3531368) has the molecular formula C20H27N5O5 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-[[2-methylpropyl-[(4-nitrophenyl)carbamoyl]amino]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2-methylpropyl)-2-[[2-methylpropyl-[(4-nitrophenyl)carbamoyl]amino]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3531368 |
| Molecular Formula | C20H27N5O5 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N-(2-methylpropyl)-2-[[2-methylpropyl-[(4-nitrophenyl)carbamoyl]amino]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)CNC(=O)c1coc(CN(CC(C)C)C(=O)Nc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H27N5O5/c1-13(2)9-21-19(26)17-12-30-18(23-17)11-24(10-14(3)4)20(27)22-15-5-7-16(8-6-15)25(28)29/h5-8,12-14H,9-11H2,1-4H3,(H,21,26)(H,22,27) |
| InChIKey | YGMIVTIJJNVVFW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|