C18H22N4O6 — CID 5109294
methyl 2-[[(4-nitrophenyl)carbamoyl-pentylamino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 5109294) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is methyl 2-[[(4-nitrophenyl)carbamoyl-pentylamino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(4-nitrophenyl)carbamoyl-pentylamino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 5109294 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | methyl 2-[[(4-nitrophenyl)carbamoyl-pentylamino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OC)co1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H22N4O6/c1-3-4-5-10-21(11-16-20-15(12-28-16)17(23)27-2)18(24)19-13-6-8-14(9-7-13)22(25)26/h6-9,12H,3-5,10-11H2,1-2H3,(H,19,24) |
| InChIKey | GPSIEEYVZYVMMS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 127.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|