C20H34N2O4 — CID 7356750
methyl 2-[[pentyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 7356750) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl 2-[[pentyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[pentyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 7356750 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | methyl 2-[[pentyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OC)co1)C(=O)C[C@H](C)CC(C)(C)C |
| InChI | InChI=1S/C20H34N2O4/c1-7-8-9-10-22(18(23)11-15(2)12-20(3,4)5)13-17-21-16(14-26-17)19(24)25-6/h14-15H,7-13H2,1-6H3/t15-/m0/s1 |
| InChIKey | HVUJEZZYIRBMBO-HNNXBMFYSA-N |
| XLogP | 4.44 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|