C22H30N2O4 — CID 4006125
methyl 2-[[(4-hexylbenzoyl)-propylamino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 4006125) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is methyl 2-[[(4-hexylbenzoyl)-propylamino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(4-hexylbenzoyl)-propylamino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4006125 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | methyl 2-[[(4-hexylbenzoyl)-propylamino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCCCCCc1ccc(C(=O)N(CCC)Cc2nc(C(=O)OC)co2)cc1 |
| InChI | InChI=1S/C22H30N2O4/c1-4-6-7-8-9-17-10-12-18(13-11-17)21(25)24(14-5-2)15-20-23-19(16-28-20)22(26)27-3/h10-13,16H,4-9,14-15H2,1-3H3 |
| InChIKey | SNNIOTAUKYQINV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|