C19H24N2O5 — CID 4538081
methyl 2-[[(4-ethylbenzoyl)-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 4538081) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is methyl 2-[[(4-ethylbenzoyl)-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(4-ethylbenzoyl)-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4538081 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | methyl 2-[[(4-ethylbenzoyl)-(3-methoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCc1ccc(C(=O)N(CCCOC)Cc2nc(C(=O)OC)co2)cc1 |
| InChI | InChI=1S/C19H24N2O5/c1-4-14-6-8-15(9-7-14)18(22)21(10-5-11-24-2)12-17-20-16(13-26-17)19(23)25-3/h6-9,13H,4-5,10-12H2,1-3H3 |
| InChIKey | KNHWGHNKLJVUHT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|