C18H20F3N3O5 — CID 4013634
methyl 2-[[3-methoxypropyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 4013634) has the molecular formula C18H20F3N3O5 and a molecular weight of 415.37 g/mol. Its IUPAC name is methyl 2-[[3-methoxypropyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[3-methoxypropyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4013634 |
| Molecular Formula | C18H20F3N3O5 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | methyl 2-[[3-methoxypropyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COCCCN(Cc1nc(C(=O)OC)co1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F3N3O5/c1-27-9-3-8-24(10-15-23-14(11-29-15)16(25)28-2)17(26)22-13-6-4-12(5-7-13)18(19,20)21/h4-7,11H,3,8-10H2,1-2H3,(H,22,26) |
| InChIKey | LDUOCBQCUQOQAO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|