C20H27N3O5 — CID 4672610
methyl 2-[[(2,6-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 4672610) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is methyl 2-[[(2,6-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(2,6-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4672610 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | methyl 2-[[(2,6-dimethylphenyl)carbamoyl-(3-ethoxypropyl)amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOCCCN(Cc1nc(C(=O)OC)co1)C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C20H27N3O5/c1-5-27-11-7-10-23(12-17-21-16(13-28-17)19(24)26-4)20(25)22-18-14(2)8-6-9-15(18)3/h6,8-9,13H,5,7,10-12H2,1-4H3,(H,22,25) |
| InChIKey | BLQGSMRZVPNOKX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|