C17H19F3N2O6S — CID 3671123
methyl 2-[[3-methoxypropyl-[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 3671123) has the molecular formula C17H19F3N2O6S and a molecular weight of 436.41 g/mol. Its IUPAC name is methyl 2-[[3-methoxypropyl-[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[3-methoxypropyl-[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 3671123 |
| Molecular Formula | C17H19F3N2O6S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | methyl 2-[[3-methoxypropyl-[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COCCCN(Cc1nc(C(=O)OC)co1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3N2O6S/c1-26-8-4-7-22(10-15-21-14(11-28-15)16(23)27-2)29(24,25)13-6-3-5-12(9-13)17(18,19)20/h3,5-6,9,11H,4,7-8,10H2,1-2H3 |
| InChIKey | SUBNKBHJYSWRPB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|