C19H25N3O6S — CID 3637655
methyl 2-[[(4-acetamidophenyl)sulfonyl-pentylamino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 3637655) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is methyl 2-[[(4-acetamidophenyl)sulfonyl-pentylamino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(4-acetamidophenyl)sulfonyl-pentylamino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 3637655 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | methyl 2-[[(4-acetamidophenyl)sulfonyl-pentylamino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OC)co1)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C19H25N3O6S/c1-4-5-6-11-22(12-18-21-17(13-28-18)19(24)27-3)29(25,26)16-9-7-15(8-10-16)20-14(2)23/h7-10,13H,4-6,11-12H2,1-3H3,(H,20,23) |
| InChIKey | SHJICEJXQKYGQH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|