C19H24N2O5S — CID 3637650
methyl 2-[[pentyl(2-phenylethenylsulfonyl)amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 3637650) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is methyl 2-[[pentyl(2-phenylethenylsulfonyl)amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[pentyl(2-phenylethenylsulfonyl)amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 3637650 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | methyl 2-[[pentyl(2-phenylethenylsulfonyl)amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OC)co1)S(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O5S/c1-3-4-8-12-21(14-18-20-17(15-26-18)19(22)25-2)27(23,24)13-11-16-9-6-5-7-10-16/h5-7,9-11,13,15H,3-4,8,12,14H2,1-2H3 |
| InChIKey | URGLJWMVEZAMGY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|