C21H29N3O3S2 — CID 6083418
N-butyl-2-[[butyl-[(E)-2-phenylethenyl]sulfonylamino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 6083418) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is N-butyl-2-[[butyl-[(E)-2-phenylethenyl]sulfonylamino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[butyl-[(E)-2-phenylethenyl]sulfonylamino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 6083418 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-butyl-2-[[butyl-[(E)-2-phenylethenyl]sulfonylamino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CN(CCCC)S(=O)(=O)/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C21H29N3O3S2/c1-3-5-13-22-21(25)19-17-28-20(23-19)16-24(14-6-4-2)29(26,27)15-12-18-10-8-7-9-11-18/h7-12,15,17H,3-6,13-14,16H2,1-2H3,(H,22,25)/b15-12+ |
| InChIKey | GHFFFPMLMJVBAO-NTCAYCPXSA-N |
| XLogP | 4.28 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|