C21H27F3N4O2S — CID 4300335
N-butyl-2-[[butyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 4300335) has the molecular formula C21H27F3N4O2S and a molecular weight of 456.53 g/mol. Its IUPAC name is N-butyl-2-[[butyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[butyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4300335 |
| Molecular Formula | C21H27F3N4O2S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-butyl-2-[[butyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CN(CCCC)C(=O)Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C21H27F3N4O2S/c1-3-5-11-25-19(29)17-14-31-18(26-17)13-28(12-6-4-2)20(30)27-16-10-8-7-9-15(16)21(22,23)24/h7-10,14H,3-6,11-13H2,1-2H3,(H,25,29)(H,27,30) |
| InChIKey | GJMBPGNFVQOVOJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|