C21H30N4O2S — CID 4001180
N-butyl-2-[[butyl-[(4-methylphenyl)carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 4001180) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-butyl-2-[[butyl-[(4-methylphenyl)carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[butyl-[(4-methylphenyl)carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4001180 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-butyl-2-[[butyl-[(4-methylphenyl)carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CN(CCCC)C(=O)Nc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C21H30N4O2S/c1-4-6-12-22-20(26)18-15-28-19(24-18)14-25(13-7-5-2)21(27)23-17-10-8-16(3)9-11-17/h8-11,15H,4-7,12-14H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | JJDDABMMQNQSLF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|