C20H26Cl2N4O4S — CID 5126664
2-[[(3,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-thiazole-4-carboxamide (PubChem CID 5126664) has the molecular formula C20H26Cl2N4O4S and a molecular weight of 489.43 g/mol. Its IUPAC name is 2-[[(3,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[(3,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 5126664 |
| Molecular Formula | C20H26Cl2N4O4S |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2-[[(3,4-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-N-(3-methoxypropyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1csc(CN(CCCOC)C(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C20H26Cl2N4O4S/c1-29-9-3-7-23-19(27)17-13-31-18(25-17)12-26(8-4-10-30-2)20(28)24-14-5-6-15(21)16(22)11-14/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | LEYKSRVZVJPVPZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|