C17H19ClFN3O4S — CID 4995261
methyl 2-[[(3-chloro-4-fluorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 4995261) has the molecular formula C17H19ClFN3O4S and a molecular weight of 415.87 g/mol. Its IUPAC name is methyl 2-[[(3-chloro-4-fluorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(3-chloro-4-fluorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 4995261 |
| Molecular Formula | C17H19ClFN3O4S |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | methyl 2-[[(3-chloro-4-fluorophenyl)carbamoyl-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | COCCCN(Cc1nc(C(=O)OC)cs1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H19ClFN3O4S/c1-25-7-3-6-22(9-15-21-14(10-27-15)16(23)26-2)17(24)20-11-4-5-13(19)12(18)8-11/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,20,24) |
| InChIKey | WZSCVIWGRFJJMJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|