C19H24N2O6S — CID 3994386
methyl 2-[[(2,6-dimethoxybenzoyl)-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3994386) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is methyl 2-[[(2,6-dimethoxybenzoyl)-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(2,6-dimethoxybenzoyl)-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3994386 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | methyl 2-[[(2,6-dimethoxybenzoyl)-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | COCCCN(Cc1nc(C(=O)OC)cs1)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C19H24N2O6S/c1-24-10-6-9-21(11-16-20-13(12-28-16)19(23)27-4)18(22)17-14(25-2)7-5-8-15(17)26-3/h5,7-8,12H,6,9-11H2,1-4H3 |
| InChIKey | NLIANJGFPZUQSZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|