C16H24N2O6S — CID 5022880
methyl 2-[[(4-ethoxy-4-oxobutanoyl)-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 5022880) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is methyl 2-[[(4-ethoxy-4-oxobutanoyl)-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(4-ethoxy-4-oxobutanoyl)-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 5022880 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | methyl 2-[[(4-ethoxy-4-oxobutanoyl)-(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)CCC(=O)N(CCCOC)Cc1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C16H24N2O6S/c1-4-24-15(20)7-6-14(19)18(8-5-9-22-2)10-13-17-12(11-25-13)16(21)23-3/h11H,4-10H2,1-3H3 |
| InChIKey | QYIQIFVNENZVFX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|