C16H26N2O4S — CID 3881091
ethyl 2-[[2,2-dimethylpropanoyl(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3881091) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is ethyl 2-[[2,2-dimethylpropanoyl(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[2,2-dimethylpropanoyl(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3881091 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | ethyl 2-[[2,2-dimethylpropanoyl(3-methoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(CN(CCCOC)C(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C16H26N2O4S/c1-6-22-14(19)12-11-23-13(17-12)10-18(8-7-9-21-5)15(20)16(2,3)4/h11H,6-10H2,1-5H3 |
| InChIKey | GATCGCVTNKMENV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|