C17H28N2O3S — CID 4046242
ethyl 2-[[pentanoyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 4046242) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is ethyl 2-[[pentanoyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[pentanoyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 4046242 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | ethyl 2-[[pentanoyl(pentyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OCC)cs1)C(=O)CCCC |
| InChI | InChI=1S/C17H28N2O3S/c1-4-7-9-11-19(16(20)10-8-5-2)12-15-18-14(13-23-15)17(21)22-6-3/h13H,4-12H2,1-3H3 |
| InChIKey | HMSWQCZEIFTALC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|