C18H30N2O3S — CID 3525760
ethyl 2-[[octanoyl(propan-2-yl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3525760) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is ethyl 2-[[octanoyl(propan-2-yl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[octanoyl(propan-2-yl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3525760 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | ethyl 2-[[octanoyl(propan-2-yl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCCCC(=O)N(Cc1nc(C(=O)OCC)cs1)C(C)C |
| InChI | InChI=1S/C18H30N2O3S/c1-5-7-8-9-10-11-17(21)20(14(3)4)12-16-19-15(13-24-16)18(22)23-6-2/h13-14H,5-12H2,1-4H3 |
| InChIKey | PFTHMJXOPVXNSF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|