C18H31N3O2S — CID 3399602
2-[[heptanoyl(propan-2-yl)amino]methyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 3399602) has the molecular formula C18H31N3O2S and a molecular weight of 353.53 g/mol. Its IUPAC name is 2-[[heptanoyl(propan-2-yl)amino]methyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[heptanoyl(propan-2-yl)amino]methyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3399602 |
| Molecular Formula | C18H31N3O2S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2-[[heptanoyl(propan-2-yl)amino]methyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCCC(=O)N(Cc1nc(C(=O)NC(C)C)cs1)C(C)C |
| InChI | InChI=1S/C18H31N3O2S/c1-6-7-8-9-10-17(22)21(14(4)5)11-16-20-15(12-24-16)18(23)19-13(2)3/h12-14H,6-11H2,1-5H3,(H,19,23) |
| InChIKey | FWQLMRSGOAUKNA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|