C24H36N4O2S — CID 3324910
N-hexyl-2-[[propan-2-yl-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 3324910) has the molecular formula C24H36N4O2S and a molecular weight of 444.65 g/mol. Its IUPAC name is N-hexyl-2-[[propan-2-yl-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-hexyl-2-[[propan-2-yl-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3324910 |
| Molecular Formula | C24H36N4O2S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-hexyl-2-[[propan-2-yl-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1csc(CN(C(=O)Nc2ccc(C(C)C)cc2)C(C)C)n1 |
| InChI | InChI=1S/C24H36N4O2S/c1-6-7-8-9-14-25-23(29)21-16-31-22(27-21)15-28(18(4)5)24(30)26-20-12-10-19(11-13-20)17(2)3/h10-13,16-18H,6-9,14-15H2,1-5H3,(H,25,29)(H,26,30) |
| InChIKey | CIEMAMKSRWUZOP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|