C21H37N3O2S — CID 4660175
2-[[decanoyl(propyl)amino]methyl]-N-propyl-1,3-thiazole-4-carboxamide (PubChem CID 4660175) has the molecular formula C21H37N3O2S and a molecular weight of 395.61 g/mol. Its IUPAC name is 2-[[decanoyl(propyl)amino]methyl]-N-propyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[decanoyl(propyl)amino]methyl]-N-propyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4660175 |
| Molecular Formula | C21H37N3O2S |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[[decanoyl(propyl)amino]methyl]-N-propyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCCCCCC(=O)N(CCC)Cc1nc(C(=O)NCCC)cs1 |
| InChI | InChI=1S/C21H37N3O2S/c1-4-7-8-9-10-11-12-13-20(25)24(15-6-3)16-19-23-18(17-27-19)21(26)22-14-5-2/h17H,4-16H2,1-3H3,(H,22,26) |
| InChIKey | GTLUYQVFVVQTBB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|