C25H33N3O4S — CID 3956928
2-[[decanoyl(furan-2-ylmethyl)amino]methyl]-N-(furan-2-ylmethyl)-1,3-thiazole-4-carboxamide (PubChem CID 3956928) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 2-[[decanoyl(furan-2-ylmethyl)amino]methyl]-N-(furan-2-ylmethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[decanoyl(furan-2-ylmethyl)amino]methyl]-N-(furan-2-ylmethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3956928 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-[[decanoyl(furan-2-ylmethyl)amino]methyl]-N-(furan-2-ylmethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCCCCCC(=O)N(Cc1ccco1)Cc1nc(C(=O)NCc2ccco2)cs1 |
| InChI | InChI=1S/C25H33N3O4S/c1-2-3-4-5-6-7-8-13-24(29)28(17-21-12-10-15-32-21)18-23-27-22(19-33-23)25(30)26-16-20-11-9-14-31-20/h9-12,14-15,19H,2-8,13,16-18H2,1H3,(H,26,30) |
| InChIKey | IALPULDENHIBGW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|