C19H23BrN2O3S — CID 4539285
ethyl 2-[[(3-bromobenzoyl)-pentylamino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 4539285) has the molecular formula C19H23BrN2O3S and a molecular weight of 439.38 g/mol. Its IUPAC name is ethyl 2-[[(3-bromobenzoyl)-pentylamino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(3-bromobenzoyl)-pentylamino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 4539285 |
| Molecular Formula | C19H23BrN2O3S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | ethyl 2-[[(3-bromobenzoyl)-pentylamino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCN(Cc1nc(C(=O)OCC)cs1)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H23BrN2O3S/c1-3-5-6-10-22(18(23)14-8-7-9-15(20)11-14)12-17-21-16(13-26-17)19(24)25-4-2/h7-9,11,13H,3-6,10,12H2,1-2H3 |
| InChIKey | HGPLUQCMDHHQDQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|