C19H22Cl2N2O4S — CID 4576164
ethyl 2-[[(3,4-dichlorobenzoyl)-(3-ethoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 4576164) has the molecular formula C19H22Cl2N2O4S and a molecular weight of 445.37 g/mol. Its IUPAC name is ethyl 2-[[(3,4-dichlorobenzoyl)-(3-ethoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(3,4-dichlorobenzoyl)-(3-ethoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 4576164 |
| Molecular Formula | C19H22Cl2N2O4S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | ethyl 2-[[(3,4-dichlorobenzoyl)-(3-ethoxypropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOCCCN(Cc1nc(C(=O)OCC)cs1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N2O4S/c1-3-26-9-5-8-23(18(24)13-6-7-14(20)15(21)10-13)11-17-22-16(12-28-17)19(25)27-4-2/h6-7,10,12H,3-5,8-9,11H2,1-2H3 |
| InChIKey | KZCJZUUYDZRWSZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|