C18H21N3O6S — CID 3547839
methyl 2-[[3-ethoxypropyl-(4-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 3547839) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is methyl 2-[[3-ethoxypropyl-(4-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[3-ethoxypropyl-(4-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3547839 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 2-[[3-ethoxypropyl-(4-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOCCCN(Cc1nc(C(=O)OC)cs1)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N3O6S/c1-3-27-10-4-9-20(11-16-19-15(12-28-16)18(23)26-2)17(22)13-5-7-14(8-6-13)21(24)25/h5-8,12H,3-4,9-11H2,1-2H3 |
| InChIKey | VWDXOJPPHHCOJR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|